C22H29O4P — CID 127258096
2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]benzene-1,4-diol (PubChem CID 127258096) has the molecular formula C22H29O4P and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]benzene-1,4-diol.
| Compound Name | 2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]benzene-1,4-diol |
|---|---|
| PubChem CID | 127258096 |
| Molecular Formula | C22H29O4P |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]benzene-1,4-diol |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OP(=O)(c1ccccc1)c1cc(O)ccc1O |
| InChI | InChI=1S/C22H29O4P/c1-15(2)19-11-9-16(3)13-21(19)26-27(25,18-7-5-4-6-8-18)22-14-17(23)10-12-20(22)24/h4-8,10,12,14-16,19,21,23-24H,9,11,13H2,1-3H3/t16-,19+,21-,27?/m1/s1 |
| InChIKey | JBEZNBGBRIUBOO-GYWMAEQFSA-N |
| XLogP | 4.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|