C23H31O3P — CID 127258140
2-methyl-6-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]phenol (PubChem CID 127258140) has the molecular formula C23H31O3P and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-methyl-6-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]phenol.
| Compound Name | 2-methyl-6-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]phenol |
|---|---|
| PubChem CID | 127258140 |
| Molecular Formula | C23H31O3P |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-methyl-6-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenylphosphoryl]phenol |
| SMILES | Cc1cccc(P(=O)(O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c2ccccc2)c1O |
| InChI | InChI=1S/C23H31O3P/c1-16(2)20-14-13-17(3)15-21(20)26-27(25,19-10-6-5-7-11-19)22-12-8-9-18(4)23(22)24/h5-12,16-17,20-21,24H,13-15H2,1-4H3/t17-,20+,21-,27?/m1/s1 |
| InChIKey | PPXUKKCDKGYWHB-CJCLZUPWSA-N |
| XLogP | 5.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|