C27H23NO — CID 12729562
2,3a-dimethyl-4,6,7a-triphenyl-1,3-benzoxazole (PubChem CID 12729562) has the molecular formula C27H23NO and a molecular weight of 377.49 g/mol. Its IUPAC name is 2,3a-dimethyl-4,6,7a-triphenyl-1,3-benzoxazole.
| Compound Name | 2,3a-dimethyl-4,6,7a-triphenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 12729562 |
| Molecular Formula | C27H23NO |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2,3a-dimethyl-4,6,7a-triphenyl-1,3-benzoxazole |
| SMILES | CC1=NC2(C)C(c3ccccc3)=CC(c3ccccc3)=CC2(c2ccccc2)O1 |
| InChI | InChI=1S/C27H23NO/c1-20-28-26(2)25(22-14-8-4-9-15-22)18-23(21-12-6-3-7-13-21)19-27(26,29-20)24-16-10-5-11-17-24/h3-19H,1-2H3 |
| InChIKey | DGYSZTQNGPGQQR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |