C20H18F2N2 — CID 1274241
(3R,7Z)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-1,2,3,4,5,6-hexahydroindazole (PubChem CID 1274241) has the molecular formula C20H18F2N2 and a molecular weight of 324.37 g/mol. Its IUPAC name is (3R,7Z)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-1,2,3,4,5,6-hexahydroindazole.
| Compound Name | (3R,7Z)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-1,2,3,4,5,6-hexahydroindazole |
|---|---|
| PubChem CID | 1274241 |
| Molecular Formula | C20H18F2N2 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (3R,7Z)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-1,2,3,4,5,6-hexahydroindazole |
| SMILES | Fc1ccc(/C=C2/CCCC3=C2NN[C@@H]3c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H18F2N2/c21-16-8-4-13(5-9-16)12-15-2-1-3-18-19(23-24-20(15)18)14-6-10-17(22)11-7-14/h4-12,19,23-24H,1-3H2/b15-12-/t19-/m1/s1 |
| InChIKey | IWBSFHONYGIUCF-LJQBUTKESA-N |
| XLogP | 4.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |