C21H18F2N2S — CID 3801862
4-(3-fluorophenyl)-8-[(3-fluorophenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione (PubChem CID 3801862) has the molecular formula C21H18F2N2S and a molecular weight of 368.45 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-8-[(3-fluorophenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione.
| Compound Name | 4-(3-fluorophenyl)-8-[(3-fluorophenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 3801862 |
| Molecular Formula | C21H18F2N2S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-(3-fluorophenyl)-8-[(3-fluorophenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
| SMILES | Fc1cccc(C=C2CCCC3=C2NC(=S)NC3c2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H18F2N2S/c22-16-7-1-4-13(11-16)10-14-6-3-9-18-19(14)24-21(26)25-20(18)15-5-2-8-17(23)12-15/h1-2,4-5,7-8,10-12,20H,3,6,9H2,(H2,24,25,26) |
| InChIKey | VSFDQQLOLZOVPE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|