C23H20N2O4S — CID 3776369
4-(1,3-benzodioxol-5-yl)-8-(1,3-benzodioxol-5-ylmethylidene)-1,3,4,5,6,7-hexahydroquinazoline-2-thione (PubChem CID 3776369) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-8-(1,3-benzodioxol-5-ylmethylidene)-1,3,4,5,6,7-hexahydroquinazoline-2-thione.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-8-(1,3-benzodioxol-5-ylmethylidene)-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 3776369 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-8-(1,3-benzodioxol-5-ylmethylidene)-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
| SMILES | S=C1NC2=C(CCCC2=Cc2ccc3c(c2)OCO3)C(c2ccc3c(c2)OCO3)N1 |
| InChI | InChI=1S/C23H20N2O4S/c30-23-24-21-14(8-13-4-6-17-19(9-13)28-11-26-17)2-1-3-16(21)22(25-23)15-5-7-18-20(10-15)29-12-27-18/h4-10,22H,1-3,11-12H2,(H2,24,25,30) |
| InChIKey | AHRJCSYPIPOTJZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|