C18H22ClNO3 — CID 12758300
2-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]-1-phenylbutane-1,3-dione;hydrochloride (PubChem CID 12758300) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is 2-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]-1-phenylbutane-1,3-dione;hydrochloride.
| Compound Name | 2-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]-1-phenylbutane-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 12758300 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-[(3-oxo-1-azabicyclo[2.2.2]octan-2-yl)methyl]-1-phenylbutane-1,3-dione;hydrochloride |
| SMILES | CC(=O)C(CC1C(=O)C2CCN1CC2)C(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C18H21NO3.ClH/c1-12(20)15(17(21)13-5-3-2-4-6-13)11-16-18(22)14-7-9-19(16)10-8-14;/h2-6,14-16H,7-11H2,1H3;1H |
| InChIKey | FJUDXHQZJHPVHS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|