C18H28N6O4 — CID 127615368
2-[3-(6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)butyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione (PubChem CID 127615368) has the molecular formula C18H28N6O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[3-(6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)butyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione.
| Compound Name | 2-[3-(6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)butyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione |
|---|---|
| PubChem CID | 127615368 |
| Molecular Formula | C18H28N6O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[3-(6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)butyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-6,7-dione |
| SMILES | CC(CCN1CCN2C(=O)C(=O)NCC2C1)N1CCN2C(=O)C(=O)NCC2C1 |
| InChI | InChI=1S/C18H28N6O4/c1-12(22-5-7-24-14(11-22)9-20-16(26)18(24)28)2-3-21-4-6-23-13(10-21)8-19-15(25)17(23)27/h12-14H,2-11H2,1H3,(H,19,25)(H,20,26) |
| InChIKey | LWNLHADTMIQYIR-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|