C10H22N4S — CID 12761702
1-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]thiourea (PubChem CID 12761702) has the molecular formula C10H22N4S and a molecular weight of 230.38 g/mol. Its IUPAC name is 1-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]thiourea.
| Compound Name | 1-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 12761702 |
| Molecular Formula | C10H22N4S |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 1-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]thiourea |
| SMILES | CNC(=S)NCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C10H22N4S/c1-11-10(15)12-4-3-5-14-8-6-13(2)7-9-14/h3-9H2,1-2H3,(H2,11,12,15) |
| InChIKey | HQPKMHGYEDSKJR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|