C20H38N6S2 — CID 3397220
1-(2-methylprop-2-enyl)-3-[3-[4-[3-(2-methylprop-2-enylcarbamothioylamino)propyl]piperazin-1-yl]propyl]thiourea (PubChem CID 3397220) has the molecular formula C20H38N6S2 and a molecular weight of 426.70 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-3-[3-[4-[3-(2-methylprop-2-enylcarbamothioylamino)propyl]piperazin-1-yl]propyl]thiourea.
| Compound Name | 1-(2-methylprop-2-enyl)-3-[3-[4-[3-(2-methylprop-2-enylcarbamothioylamino)propyl]piperazin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 3397220 |
| Molecular Formula | C20H38N6S2 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-3-[3-[4-[3-(2-methylprop-2-enylcarbamothioylamino)propyl]piperazin-1-yl]propyl]thiourea |
| SMILES | C=C(C)CNC(=S)NCCCN1CCN(CCCNC(=S)NCC(=C)C)CC1 |
| InChI | InChI=1S/C20H38N6S2/c1-17(2)15-23-19(27)21-7-5-9-25-11-13-26(14-12-25)10-6-8-22-20(28)24-16-18(3)4/h1,3,5-16H2,2,4H3,(H2,21,23,27)(H2,22,24,28) |
| InChIKey | WHFCWTVWKHZFGM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|