C15H23F2N5O2 — CID 127683861
1-(4,4-difluorocyclohexyl)-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea (PubChem CID 127683861) has the molecular formula C15H23F2N5O2 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea.
| Compound Name | 1-(4,4-difluorocyclohexyl)-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 127683861 |
| Molecular Formula | C15H23F2N5O2 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-3-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea |
| SMILES | COCc1nc2n(n1)CC(NC(=O)NC1CCC(F)(F)CC1)CC2 |
| InChI | InChI=1S/C15H23F2N5O2/c1-24-9-12-20-13-3-2-11(8-22(13)21-12)19-14(23)18-10-4-6-15(16,17)7-5-10/h10-11H,2-9H2,1H3,(H2,18,19,23) |
| InChIKey | FYMWMIRUEUKQOO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |