C10H18O5 — CID 12770202
2-(dimethoxymethyl)-2,5-dimethoxy-5-methylfuran (PubChem CID 12770202) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-2,5-dimethoxy-5-methylfuran.
| Compound Name | 2-(dimethoxymethyl)-2,5-dimethoxy-5-methylfuran |
|---|---|
| PubChem CID | 12770202 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-(dimethoxymethyl)-2,5-dimethoxy-5-methylfuran |
| SMILES | COC(OC)C1(OC)C=CC(C)(OC)O1 |
| InChI | InChI=1S/C10H18O5/c1-9(13-4)6-7-10(14-5,15-9)8(11-2)12-3/h6-8H,1-5H3 |
| InChIKey | WDDBVURGAVJXBZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|