C18H20N2O4S — CID 127804839
2-(4-isoquinolin-5-ylsulfonylmorpholin-3-yl)cyclopentan-1-one (PubChem CID 127804839) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-(4-isoquinolin-5-ylsulfonylmorpholin-3-yl)cyclopentan-1-one.
| Compound Name | 2-(4-isoquinolin-5-ylsulfonylmorpholin-3-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 127804839 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-(4-isoquinolin-5-ylsulfonylmorpholin-3-yl)cyclopentan-1-one |
| SMILES | O=C1CCCC1C1COCCN1S(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C18H20N2O4S/c21-17-5-2-4-15(17)16-12-24-10-9-20(16)25(22,23)18-6-1-3-13-11-19-8-7-14(13)18/h1,3,6-8,11,15-16H,2,4-5,9-10,12H2 |
| InChIKey | ORBXNXJUSGOGNU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |