C13H16O2 — CID 12781280
1-propan-2-yl-3,4-dihydroisochromene-1-carbaldehyde (PubChem CID 12781280) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-propan-2-yl-3,4-dihydroisochromene-1-carbaldehyde.
| Compound Name | 1-propan-2-yl-3,4-dihydroisochromene-1-carbaldehyde |
|---|---|
| PubChem CID | 12781280 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1-propan-2-yl-3,4-dihydroisochromene-1-carbaldehyde |
| SMILES | CC(C)C1(C=O)OCCc2ccccc21 |
| InChI | InChI=1S/C13H16O2/c1-10(2)13(9-14)12-6-4-3-5-11(12)7-8-15-13/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | QCBIAXJZMUZVQZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|