C21H17ClN2S2 — CID 12783522
2-benzyl-N-(3-chlorophenyl)-2H-1,3-benzothiazole-3-carbothioamide (PubChem CID 12783522) has the molecular formula C21H17ClN2S2 and a molecular weight of 396.97 g/mol. Its IUPAC name is 2-benzyl-N-(3-chlorophenyl)-2H-1,3-benzothiazole-3-carbothioamide.
| Compound Name | 2-benzyl-N-(3-chlorophenyl)-2H-1,3-benzothiazole-3-carbothioamide |
|---|---|
| PubChem CID | 12783522 |
| Molecular Formula | C21H17ClN2S2 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-benzyl-N-(3-chlorophenyl)-2H-1,3-benzothiazole-3-carbothioamide |
| SMILES | S=C(Nc1cccc(Cl)c1)N1c2ccccc2SC1Cc1ccccc1 |
| InChI | InChI=1S/C21H17ClN2S2/c22-16-9-6-10-17(14-16)23-21(25)24-18-11-4-5-12-19(18)26-20(24)13-15-7-2-1-3-8-15/h1-12,14,20H,13H2,(H,23,25) |
| InChIKey | HKOSTLSYEBTBCV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|