C30H33N5 — CID 12796085
N-(2-ethylhexyl)-1-[(4-phenyldiazenylphenyl)diazenyl]naphthalen-2-amine (PubChem CID 12796085) has the molecular formula C30H33N5 and a molecular weight of 463.63 g/mol. Its IUPAC name is N-(2-ethylhexyl)-1-[(4-phenyldiazenylphenyl)diazenyl]naphthalen-2-amine.
| Compound Name | N-(2-ethylhexyl)-1-[(4-phenyldiazenylphenyl)diazenyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 12796085 |
| Molecular Formula | C30H33N5 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | N-(2-ethylhexyl)-1-[(4-phenyldiazenylphenyl)diazenyl]naphthalen-2-amine |
| SMILES | CCCCC(CC)CNc1ccc2ccccc2c1/N=N/c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C30H33N5/c1-3-5-11-23(4-2)22-31-29-21-16-24-12-9-10-15-28(24)30(29)35-34-27-19-17-26(18-20-27)33-32-25-13-7-6-8-14-25/h6-10,12-21,23,31H,3-5,11,22H2,1-2H3/b33-32+,35-34+ |
| InChIKey | ODGIBNBBFYAOOP-VPHDGDOJSA-N |
| XLogP | 10.30 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|