C9H9N3OS2 — CID 1280746
N-(1,3-dithiolan-2-ylideneamino)pyridine-4-carboxamide (PubChem CID 1280746) has the molecular formula C9H9N3OS2 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-(1,3-dithiolan-2-ylideneamino)pyridine-4-carboxamide.
| Compound Name | N-(1,3-dithiolan-2-ylideneamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 1280746 |
| Molecular Formula | C9H9N3OS2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | N-(1,3-dithiolan-2-ylideneamino)pyridine-4-carboxamide |
| SMILES | O=C(NN=C1SCCS1)c1ccncc1 |
| InChI | InChI=1S/C9H9N3OS2/c13-8(7-1-3-10-4-2-7)11-12-9-14-5-6-15-9/h1-4H,5-6H2,(H,11,13) |
| InChIKey | FJBIRXZBSCRXOA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|