About N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide
N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide (PubChem CID 3605149) has the molecular formula C11H9N5O4
and a molecular weight of 275.22 g/mol. Its IUPAC name is N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide |
| PubChem CID | 3605149 |
| Molecular Formula | C11H9N5O4 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide |
| SMILES | NC(=O)C1C(=O)NC(=O)C1=NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C11H9N5O4/c12-8(17)6-7(11(20)14-10(6)19)15-16-9(18)5-1-3-13-4-2-5/h1-4,6H,(H2,12,17)(H,16,18)(H,14,19,20) |
| InChIKey | NVULSRRPMCKMFP-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 143.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide?
The IUPAC name of N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide (CID 3605149) is N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide.
What is the SMILES notation for N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide?
The canonical SMILES for N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide is NC(=O)C1C(=O)NC(=O)C1=NNC(=O)c1ccncc1.
What is the InChIKey of N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide?
The InChIKey is NVULSRRPMCKMFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5O4/c12-8(17)6-7(11(20)14-10(6)19)15-16-9(18)5-1-3-13-4-2-5/h1-4,6H,(H2,12,17)(H,16,18)(H,14,19,20).
What are the key properties of N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide?
N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide has a molecular weight of 275.22 g/mol, XLogP of -2.07, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide is sourced from PubChem (CID 3605149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).