C11H9N5O4 — CID 3605149
N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide (PubChem CID 3605149) has the molecular formula C11H9N5O4 and a molecular weight of 275.22 g/mol. Its IUPAC name is N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide.
| Compound Name | N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 3605149 |
| Molecular Formula | C11H9N5O4 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-[(4-carbamoyl-2,5-dioxopyrrolidin-3-ylidene)amino]pyridine-4-carboxamide |
| SMILES | NC(=O)C1C(=O)NC(=O)C1=NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C11H9N5O4/c12-8(17)6-7(11(20)14-10(6)19)15-16-9(18)5-1-3-13-4-2-5/h1-4,6H,(H2,12,17)(H,16,18)(H,14,19,20) |
| InChIKey | NVULSRRPMCKMFP-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 143.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|