C13H18N6 — CID 1280814
1-(1H-imidazo[4,5-b]pyridin-2-yl)-N-(4-methylpiperazin-1-yl)ethanimine (PubChem CID 1280814) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is 1-(1H-imidazo[4,5-b]pyridin-2-yl)-N-(4-methylpiperazin-1-yl)ethanimine.
| Compound Name | 1-(1H-imidazo[4,5-b]pyridin-2-yl)-N-(4-methylpiperazin-1-yl)ethanimine |
|---|---|
| PubChem CID | 1280814 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-(1H-imidazo[4,5-b]pyridin-2-yl)-N-(4-methylpiperazin-1-yl)ethanimine |
| SMILES | CC(=NN1CCN(C)CC1)c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C13H18N6/c1-10(17-19-8-6-18(2)7-9-19)12-15-11-4-3-5-14-13(11)16-12/h3-5H,6-9H2,1-2H3,(H,14,15,16) |
| InChIKey | QSKJCTWMXXUOAK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|