C24H41N4OP — CID 1281440
4-[(S)-di(piperidin-1-yl)phosphoryl-piperidin-1-ylmethyl]-N,N-dimethylaniline (PubChem CID 1281440) has the molecular formula C24H41N4OP and a molecular weight of 432.59 g/mol. Its IUPAC name is 4-[(S)-di(piperidin-1-yl)phosphoryl-piperidin-1-ylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(S)-di(piperidin-1-yl)phosphoryl-piperidin-1-ylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 1281440 |
| Molecular Formula | C24H41N4OP |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 4-[(S)-di(piperidin-1-yl)phosphoryl-piperidin-1-ylmethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@@H](N2CCCCC2)P(=O)(N2CCCCC2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H41N4OP/c1-25(2)23-14-12-22(13-15-23)24(26-16-6-3-7-17-26)30(29,27-18-8-4-9-19-27)28-20-10-5-11-21-28/h12-15,24H,3-11,16-21H2,1-2H3/t24-/m0/s1 |
| InChIKey | WSXIGQHISJGPMG-DEOSSOPVSA-N |
| XLogP | 5.40 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|