C24H42N4OP+ — CID 7124467
4-[(R)-di(piperidin-1-yl)phosphoryl-piperidin-1-ium-1-ylmethyl]-N,N-dimethylaniline (PubChem CID 7124467) has the molecular formula C24H42N4OP+ and a molecular weight of 433.60 g/mol. Its IUPAC name is 4-[(R)-di(piperidin-1-yl)phosphoryl-piperidin-1-ium-1-ylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(R)-di(piperidin-1-yl)phosphoryl-piperidin-1-ium-1-ylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7124467 |
| Molecular Formula | C24H42N4OP+ |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | 4-[(R)-di(piperidin-1-yl)phosphoryl-piperidin-1-ium-1-ylmethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@H]([NH+]2CCCCC2)P(=O)(N2CCCCC2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H41N4OP/c1-25(2)23-14-12-22(13-15-23)24(26-16-6-3-7-17-26)30(29,27-18-8-4-9-19-27)28-20-10-5-11-21-28/h12-15,24H,3-11,16-21H2,1-2H3/p+1/t24-/m1/s1 |
| InChIKey | WSXIGQHISJGPMG-XMMPIXPASA-O |
| XLogP | 3.98 |
| TPSA | 31.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|