C17H23NO4 — CID 12827402
2-methyl-6-phenyl-2-azabicyclo[4.2.1]nonane;oxalic acid (PubChem CID 12827402) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-methyl-6-phenyl-2-azabicyclo[4.2.1]nonane;oxalic acid.
| Compound Name | 2-methyl-6-phenyl-2-azabicyclo[4.2.1]nonane;oxalic acid |
|---|---|
| PubChem CID | 12827402 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-methyl-6-phenyl-2-azabicyclo[4.2.1]nonane;oxalic acid |
| SMILES | CN1CCCC2(c3ccccc3)CCC1C2.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H21N.C2H2O4/c1-16-11-5-9-15(10-8-14(16)12-15)13-6-3-2-4-7-13;3-1(4)2(5)6/h2-4,6-7,14H,5,8-12H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | YLXKGSAHNMGNLM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|