C23H27NO4 — CID 3045747
oxalic acid;1-phenyl-6-(2-phenylethyl)-6-azabicyclo[3.2.1]octane (PubChem CID 3045747) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is oxalic acid;1-phenyl-6-(2-phenylethyl)-6-azabicyclo[3.2.1]octane.
| Compound Name | oxalic acid;1-phenyl-6-(2-phenylethyl)-6-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 3045747 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | oxalic acid;1-phenyl-6-(2-phenylethyl)-6-azabicyclo[3.2.1]octane |
| SMILES | O=C(O)C(=O)O.c1ccc(CCN2CC3(c4ccccc4)CCCC2C3)cc1 |
| InChI | InChI=1S/C21H25N.C2H2O4/c1-3-8-18(9-4-1)13-15-22-17-21(14-7-12-20(22)16-21)19-10-5-2-6-11-19;3-1(4)2(5)6/h1-6,8-11,20H,7,12-17H2;(H,3,4)(H,5,6) |
| InChIKey | PYYOMBMWKCSALI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|