C18H23NO4 — CID 3045745
oxalic acid;1-phenyl-6-prop-2-enyl-6-azabicyclo[3.2.1]octane (PubChem CID 3045745) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is oxalic acid;1-phenyl-6-prop-2-enyl-6-azabicyclo[3.2.1]octane.
| Compound Name | oxalic acid;1-phenyl-6-prop-2-enyl-6-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 3045745 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | oxalic acid;1-phenyl-6-prop-2-enyl-6-azabicyclo[3.2.1]octane |
| SMILES | C=CCN1CC2(c3ccccc3)CCCC1C2.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H21N.C2H2O4/c1-2-11-17-13-16(10-6-9-15(17)12-16)14-7-4-3-5-8-14;3-1(4)2(5)6/h2-5,7-8,15H,1,6,9-13H2;(H,3,4)(H,5,6) |
| InChIKey | SAGDGXPGYPOFSX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|