C19H19NO4 — CID 12533751
17-methyl-17-azatetracyclo[8.6.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene;oxalic acid (PubChem CID 12533751) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 17-methyl-17-azatetracyclo[8.6.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene;oxalic acid.
| Compound Name | 17-methyl-17-azatetracyclo[8.6.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene;oxalic acid |
|---|---|
| PubChem CID | 12533751 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 17-methyl-17-azatetracyclo[8.6.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene;oxalic acid |
| SMILES | CN1C2CCc3ccccc3C1c1ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H17N.C2H2O4/c1-18-16-11-10-12-6-2-3-7-13(12)17(18)15-9-5-4-8-14(15)16;3-1(4)2(5)6/h2-9,16-17H,10-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | OLVYUMYINJSZCF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|