C17H27IN2O3S — CID 12833661
methyl N-butyl-N'-[[2-(4-methoxyphenyl)-1,3-dioxolan-2-yl]methyl]carbamimidothioate;hydroiodide (PubChem CID 12833661) has the molecular formula C17H27IN2O3S and a molecular weight of 466.39 g/mol. Its IUPAC name is methyl N-butyl-N'-[[2-(4-methoxyphenyl)-1,3-dioxolan-2-yl]methyl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N-butyl-N'-[[2-(4-methoxyphenyl)-1,3-dioxolan-2-yl]methyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 12833661 |
| Molecular Formula | C17H27IN2O3S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | methyl N-butyl-N'-[[2-(4-methoxyphenyl)-1,3-dioxolan-2-yl]methyl]carbamimidothioate;hydroiodide |
| SMILES | CCCCN/C(=N/CC1(c2ccc(OC)cc2)OCCO1)SC.I |
| InChI | InChI=1S/C17H26N2O3S.HI/c1-4-5-10-18-16(23-3)19-13-17(21-11-12-22-17)14-6-8-15(20-2)9-7-14;/h6-9H,4-5,10-13H2,1-3H3,(H,18,19);1H |
| InChIKey | YACYWTLXQYELSO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|