About 4-benzoyl-2H-1,2,4-triazine-3,5-dione
4-benzoyl-2H-1,2,4-triazine-3,5-dione (PubChem CID 12850111) has the molecular formula C10H7N3O3
and a molecular weight of 217.18 g/mol. Its IUPAC name is 4-benzoyl-2H-1,2,4-triazine-3,5-dione.
Molecular Properties
| Compound Name | 4-benzoyl-2H-1,2,4-triazine-3,5-dione |
| PubChem CID | 12850111 |
| Molecular Formula | C10H7N3O3 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 4-benzoyl-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=C(c1ccccc1)n1c(=O)cn[nH]c1=O |
| InChI | InChI=1S/C10H7N3O3/c14-8-6-11-12-10(16)13(8)9(15)7-4-2-1-3-5-7/h1-6H,(H,12,16) |
| InChIKey | LNKCNEFCVSHAMA-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-benzoyl-2H-1,2,4-triazine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzoyl-2H-1,2,4-triazine-3,5-dione?
The IUPAC name of 4-benzoyl-2H-1,2,4-triazine-3,5-dione (CID 12850111) is 4-benzoyl-2H-1,2,4-triazine-3,5-dione.
What is the SMILES notation for 4-benzoyl-2H-1,2,4-triazine-3,5-dione?
The canonical SMILES for 4-benzoyl-2H-1,2,4-triazine-3,5-dione is O=C(c1ccccc1)n1c(=O)cn[nH]c1=O.
What is the InChIKey of 4-benzoyl-2H-1,2,4-triazine-3,5-dione?
The InChIKey is LNKCNEFCVSHAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O3/c14-8-6-11-12-10(16)13(8)9(15)7-4-2-1-3-5-7/h1-6H,(H,12,16).
What are the key properties of 4-benzoyl-2H-1,2,4-triazine-3,5-dione?
4-benzoyl-2H-1,2,4-triazine-3,5-dione has a molecular weight of 217.18 g/mol, XLogP of -0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzoyl-2H-1,2,4-triazine-3,5-dione is sourced from PubChem (CID 12850111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).