C19H25N5O3S — CID 12850850
methyl N-cyano-N'-[4-[3-(3,4-dimethoxyphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]butyl]carbamimidothioate (PubChem CID 12850850) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is methyl N-cyano-N'-[4-[3-(3,4-dimethoxyphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]butyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4-[3-(3,4-dimethoxyphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]butyl]carbamimidothioate |
|---|---|
| PubChem CID | 12850850 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | methyl N-cyano-N'-[4-[3-(3,4-dimethoxyphenyl)-6-oxo-4,5-dihydropyridazin-1-yl]butyl]carbamimidothioate |
| SMILES | COc1ccc(C2=NN(CCCC/N=C(/NC#N)SC)C(=O)CC2)cc1OC |
| InChI | InChI=1S/C19H25N5O3S/c1-26-16-8-6-14(12-17(16)27-2)15-7-9-18(25)24(23-15)11-5-4-10-21-19(28-3)22-13-20/h6,8,12H,4-5,7,9-11H2,1-3H3,(H,21,22) |
| InChIKey | OTDYZJKFHDUYES-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 99.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|