C17H21ClN6O — CID 12849122
2-[3-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]propyl]-1-cyano-3-ethylguanidine (PubChem CID 12849122) has the molecular formula C17H21ClN6O and a molecular weight of 360.85 g/mol. Its IUPAC name is 2-[3-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]propyl]-1-cyano-3-ethylguanidine.
| Compound Name | 2-[3-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]propyl]-1-cyano-3-ethylguanidine |
|---|---|
| PubChem CID | 12849122 |
| Molecular Formula | C17H21ClN6O |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-[3-[3-(4-chlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]propyl]-1-cyano-3-ethylguanidine |
| SMILES | CCN/C(=N/CCCN1N=C(c2ccc(Cl)cc2)CCC1=O)NC#N |
| InChI | InChI=1S/C17H21ClN6O/c1-2-20-17(22-12-19)21-10-3-11-24-16(25)9-8-15(23-24)13-4-6-14(18)7-5-13/h4-7H,2-3,8-11H2,1H3,(H2,20,21,22) |
| InChIKey | GRMKEVMOILQCDD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|