C28H39ClN6O2 — CID 142680615
N'-[3-(4-tert-butylcyclohexyl)oxypropyl]-5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142680615) has the molecular formula C28H39ClN6O2 and a molecular weight of 527.11 g/mol. Its IUPAC name is N'-[3-(4-tert-butylcyclohexyl)oxypropyl]-5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N'-[3-(4-tert-butylcyclohexyl)oxypropyl]-5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142680615 |
| Molecular Formula | C28H39ClN6O2 |
| Molecular Weight | 527.11 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | N'-[3-(4-tert-butylcyclohexyl)oxypropyl]-5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC(C)(C)C1CCC(OCCC/N=C(\NC#N)N2CC(N3CCCC3=O)C(c3ccc(Cl)cc3)=N2)CC1 |
| InChI | InChI=1S/C28H39ClN6O2/c1-28(2,3)21-9-13-23(14-10-21)37-17-5-15-31-27(32-19-30)35-18-24(34-16-4-6-25(34)36)26(33-35)20-7-11-22(29)12-8-20/h7-8,11-12,21,23-24H,4-6,9-10,13-18H2,1-3H3,(H,31,32) |
| InChIKey | PYWDIOQCPOAMLL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.11 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|