C18H22Cl2N6O — CID 12849105
1-cyano-3-[5-[3-(3,4-dichlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]-2-methylguanidine (PubChem CID 12849105) has the molecular formula C18H22Cl2N6O and a molecular weight of 409.32 g/mol. Its IUPAC name is 1-cyano-3-[5-[3-(3,4-dichlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[5-[3-(3,4-dichlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]-2-methylguanidine |
|---|---|
| PubChem CID | 12849105 |
| Molecular Formula | C18H22Cl2N6O |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 1-cyano-3-[5-[3-(3,4-dichlorophenyl)-6-oxo-4,5-dihydropyridazin-1-yl]pentyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCCCCN1N=C(c2ccc(Cl)c(Cl)c2)CCC1=O |
| InChI | InChI=1S/C18H22Cl2N6O/c1-22-18(24-12-21)23-9-3-2-4-10-26-17(27)8-7-16(25-26)13-5-6-14(19)15(20)11-13/h5-6,11H,2-4,7-10H2,1H3,(H2,22,23,24) |
| InChIKey | QRWLNOATGWBPBR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|