C11H18N6O — CID 57032802
1-cyano-2-methyl-3-[3-[(4-methyl-1,3-oxazol-5-yl)methylamino]propyl]guanidine (PubChem CID 57032802) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[3-[(4-methyl-1,3-oxazol-5-yl)methylamino]propyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[3-[(4-methyl-1,3-oxazol-5-yl)methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 57032802 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-cyano-2-methyl-3-[3-[(4-methyl-1,3-oxazol-5-yl)methylamino]propyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCCNCc1ocnc1C |
| InChI | InChI=1S/C11H18N6O/c1-9-10(18-8-17-9)6-14-4-3-5-15-11(13-2)16-7-12/h8,14H,3-6H2,1-2H3,(H2,13,15,16) |
| InChIKey | QPSOVFDXXZKJLQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|