C10H15N5S — CID 23330860
1-cyano-2-methyl-3-[4-(1,3-thiazol-4-yl)butyl]guanidine (PubChem CID 23330860) has the molecular formula C10H15N5S and a molecular weight of 237.33 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[4-(1,3-thiazol-4-yl)butyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[4-(1,3-thiazol-4-yl)butyl]guanidine |
|---|---|
| PubChem CID | 23330860 |
| Molecular Formula | C10H15N5S |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-cyano-2-methyl-3-[4-(1,3-thiazol-4-yl)butyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCCCc1cscn1 |
| InChI | InChI=1S/C10H15N5S/c1-12-10(14-7-11)13-5-3-2-4-9-6-16-8-15-9/h6,8H,2-5H2,1H3,(H2,12,13,14) |
| InChIKey | UQDTYGOTTXUACL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|