C12H5BrF10N2O — CID 12865393
(2Z)-2-[(4-bromophenyl)hydrazinylidene]-1,1,1,4,4,5,5,6,6,6-decafluorohexan-3-one (PubChem CID 12865393) has the molecular formula C12H5BrF10N2O and a molecular weight of 463.07 g/mol. Its IUPAC name is (2Z)-2-[(4-bromophenyl)hydrazinylidene]-1,1,1,4,4,5,5,6,6,6-decafluorohexan-3-one.
| Compound Name | (2Z)-2-[(4-bromophenyl)hydrazinylidene]-1,1,1,4,4,5,5,6,6,6-decafluorohexan-3-one |
|---|---|
| PubChem CID | 12865393 |
| Molecular Formula | C12H5BrF10N2O |
| Molecular Weight | 463.07 g/mol |
| Exact Mass | 461.94 |
| IUPAC Name | (2Z)-2-[(4-bromophenyl)hydrazinylidene]-1,1,1,4,4,5,5,6,6,6-decafluorohexan-3-one |
| SMILES | O=C(/C(=N/Nc1ccc(Br)cc1)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H5BrF10N2O/c13-5-1-3-6(4-2-5)24-25-7(10(16,17)18)8(26)9(14,15)11(19,20)12(21,22)23/h1-4,24H/b25-7- |
| InChIKey | BHXWYFUFCKVEPR-ONAMSPKSSA-N |
| XLogP | 5.18 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.07 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|