C10H20N2 — CID 12869903
3,3-dimethyl-1,4-diazaspiro[4.5]decane (PubChem CID 12869903) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 3,3-dimethyl-1,4-diazaspiro[4.5]decane.
| Compound Name | 3,3-dimethyl-1,4-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 12869903 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 3,3-dimethyl-1,4-diazaspiro[4.5]decane |
| SMILES | CC1(C)CNC2(CCCCC2)N1 |
| InChI | InChI=1S/C10H20N2/c1-9(2)8-11-10(12-9)6-4-3-5-7-10/h11-12H,3-8H2,1-2H3 |
| InChIKey | GVYMMUMBTIKXGG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |