C19H17ClFN3O4 — CID 1289001
(3S)-1-(3-chloro-4-fluorophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 1289001) has the molecular formula C19H17ClFN3O4 and a molecular weight of 405.81 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-fluorophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3-chloro-4-fluorophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1289001 |
| Molecular Formula | C19H17ClFN3O4 |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (3S)-1-(3-chloro-4-fluorophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C(c1ccco1)N1CCN([C@H]2CC(=O)N(c3ccc(F)c(Cl)c3)C2=O)CC1 |
| InChI | InChI=1S/C19H17ClFN3O4/c20-13-10-12(3-4-14(13)21)24-17(25)11-15(18(24)26)22-5-7-23(8-6-22)19(27)16-2-1-9-28-16/h1-4,9-10,15H,5-8,11H2/t15-/m0/s1 |
| InChIKey | SXEPLOATSJYNLY-HNNXBMFYSA-N |
| XLogP | 2.16 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|