C11H19ClN2O4S — CID 128962618
ethyl 5-(carbamimidoylsulfanylmethyl)-3-ethyl-2-oxooxolane-3-carboxylate;hydrochloride (PubChem CID 128962618) has the molecular formula C11H19ClN2O4S and a molecular weight of 310.80 g/mol. Its IUPAC name is ethyl 5-(carbamimidoylsulfanylmethyl)-3-ethyl-2-oxooxolane-3-carboxylate;hydrochloride.
| Compound Name | ethyl 5-(carbamimidoylsulfanylmethyl)-3-ethyl-2-oxooxolane-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 128962618 |
| Molecular Formula | C11H19ClN2O4S |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | ethyl 5-(carbamimidoylsulfanylmethyl)-3-ethyl-2-oxooxolane-3-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)SCC1CC(CC)(C(=O)OCC)C(=O)O1 |
| InChI | InChI=1S/C11H18N2O4S.ClH/c1-3-11(8(14)16-4-2)5-7(17-9(11)15)6-18-10(12)13;/h7H,3-6H2,1-2H3,(H3,12,13);1H |
| InChIKey | OIONSWFTFRPAOC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|