C14H19Cl3O6 — CID 23265257
ethyl 3-butyl-2-oxo-5-[(2,2,2-trichloroacetyl)oxymethyl]oxolane-3-carboxylate (PubChem CID 23265257) has the molecular formula C14H19Cl3O6 and a molecular weight of 389.66 g/mol. Its IUPAC name is ethyl 3-butyl-2-oxo-5-[(2,2,2-trichloroacetyl)oxymethyl]oxolane-3-carboxylate.
| Compound Name | ethyl 3-butyl-2-oxo-5-[(2,2,2-trichloroacetyl)oxymethyl]oxolane-3-carboxylate |
|---|---|
| PubChem CID | 23265257 |
| Molecular Formula | C14H19Cl3O6 |
| Molecular Weight | 389.66 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | ethyl 3-butyl-2-oxo-5-[(2,2,2-trichloroacetyl)oxymethyl]oxolane-3-carboxylate |
| SMILES | CCCCC1(C(=O)OCC)CC(COC(=O)C(Cl)(Cl)Cl)OC1=O |
| InChI | InChI=1S/C14H19Cl3O6/c1-3-5-6-13(10(18)21-4-2)7-9(23-11(13)19)8-22-12(20)14(15,16)17/h9H,3-8H2,1-2H3 |
| InChIKey | ZVFKACWZQMKGDW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|