C11H18N2O4S — CID 6339316
ethyl (3R,5R)-5-(carbamimidoylsulfanylmethyl)-3-ethyl-2-oxooxolane-3-carboxylate (PubChem CID 6339316) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is ethyl (3R,5R)-5-(carbamimidoylsulfanylmethyl)-3-ethyl-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl (3R,5R)-5-(carbamimidoylsulfanylmethyl)-3-ethyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 6339316 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethyl (3R,5R)-5-(carbamimidoylsulfanylmethyl)-3-ethyl-2-oxooxolane-3-carboxylate |
| SMILES | [H]/N=C(\N)SC[C@H]1C[C@](CC)(C(=O)OCC)C(=O)O1 |
| InChI | InChI=1S/C11H18N2O4S/c1-3-11(8(14)16-4-2)5-7(17-9(11)15)6-18-10(12)13/h7H,3-6H2,1-2H3,(H3,12,13)/t7-,11-/m1/s1 |
| InChIKey | PCNYWKNVPTYZLX-RDDDGLTNSA-N |
| XLogP | 0.89 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|