C19H25FN4O4 — CID 129003617
2-[4-ethyl-3-[(2S,3R)-3-methyloxolan-2-yl]-5-oxo-1,2,4-triazol-1-yl]-N-[2-(3-fluorophenoxy)ethyl]acetamide (PubChem CID 129003617) has the molecular formula C19H25FN4O4 and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-[4-ethyl-3-[(2S,3R)-3-methyloxolan-2-yl]-5-oxo-1,2,4-triazol-1-yl]-N-[2-(3-fluorophenoxy)ethyl]acetamide.
| Compound Name | 2-[4-ethyl-3-[(2S,3R)-3-methyloxolan-2-yl]-5-oxo-1,2,4-triazol-1-yl]-N-[2-(3-fluorophenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 129003617 |
| Molecular Formula | C19H25FN4O4 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[4-ethyl-3-[(2S,3R)-3-methyloxolan-2-yl]-5-oxo-1,2,4-triazol-1-yl]-N-[2-(3-fluorophenoxy)ethyl]acetamide |
| SMILES | CCn1c([C@H]2OCC[C@H]2C)nn(CC(=O)NCCOc2cccc(F)c2)c1=O |
| InChI | InChI=1S/C19H25FN4O4/c1-3-23-18(17-13(2)7-9-28-17)22-24(19(23)26)12-16(25)21-8-10-27-15-6-4-5-14(20)11-15/h4-6,11,13,17H,3,7-10,12H2,1-2H3,(H,21,25)/t13-,17+/m1/s1 |
| InChIKey | LZEURNWJVPSZBY-DYVFJYSZSA-N |
| XLogP | 1.50 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|