C25H31ClO5 — CID 129011513
(2S,4S)-2-chloro-4-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,6,8-trihydroxy-2-(3-methylbut-2-enyl)naphthalene-1,3-dione (PubChem CID 129011513) has the molecular formula C25H31ClO5 and a molecular weight of 446.97 g/mol. Its IUPAC name is (2S,4S)-2-chloro-4-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,6,8-trihydroxy-2-(3-methylbut-2-enyl)naphthalene-1,3-dione.
| Compound Name | (2S,4S)-2-chloro-4-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,6,8-trihydroxy-2-(3-methylbut-2-enyl)naphthalene-1,3-dione |
|---|---|
| PubChem CID | 129011513 |
| Molecular Formula | C25H31ClO5 |
| Molecular Weight | 446.97 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (2S,4S)-2-chloro-4-[(2E)-3,7-dimethylocta-2,6-dienyl]-4,6,8-trihydroxy-2-(3-methylbut-2-enyl)naphthalene-1,3-dione |
| SMILES | CC(C)=CCC/C(C)=C/C[C@@]1(O)C(=O)[C@](Cl)(CC=C(C)C)C(=O)c2c(O)cc(O)cc21 |
| InChI | InChI=1S/C25H31ClO5/c1-15(2)7-6-8-17(5)10-12-25(31)19-13-18(27)14-20(28)21(19)22(29)24(26,23(25)30)11-9-16(3)4/h7,9-10,13-14,27-28,31H,6,8,11-12H2,1-5H3/b17-10+/t24-,25-/m0/s1 |
| InChIKey | LFFBTGIIOTVWFQ-GFNWSNCPSA-N |
| XLogP | 5.47 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.97 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|