C25H29ClO4 — CID 76853551
(9R)-9-chloro-4,6-dihydroxy-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2(7),3,5-triene-8,15-dione (PubChem CID 76853551) has the molecular formula C25H29ClO4 and a molecular weight of 428.96 g/mol. Its IUPAC name is (9R)-9-chloro-4,6-dihydroxy-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2(7),3,5-triene-8,15-dione.
| Compound Name | (9R)-9-chloro-4,6-dihydroxy-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2(7),3,5-triene-8,15-dione |
|---|---|
| PubChem CID | 76853551 |
| Molecular Formula | C25H29ClO4 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (9R)-9-chloro-4,6-dihydroxy-10-methyl-10-(4-methylpent-3-enyl)-13-propan-2-ylidenetetracyclo[7.5.1.01,11.02,7]pentadeca-2(7),3,5-triene-8,15-dione |
| SMILES | CC(C)=CCCC1(C)C2CC(=C(C)C)CC23C(=O)[C@@]1(Cl)C(=O)c1c(O)cc(O)cc13 |
| InChI | InChI=1S/C25H29ClO4/c1-13(2)7-6-8-23(5)19-9-15(14(3)4)12-24(19)17-10-16(27)11-18(28)20(17)21(29)25(23,26)22(24)30/h7,10-11,19,27-28H,6,8-9,12H2,1-5H3/t19?,23?,24?,25-/m0/s1 |
| InChIKey | HZPYWBLIVTTWQN-TUCXWACFSA-N |
| XLogP | 5.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|