C22H27N3O5 — CID 129011847
methyl 3-[(2E)-2-cyclopentyloxyiminoethyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carboxylate (PubChem CID 129011847) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is methyl 3-[(2E)-2-cyclopentyloxyiminoethyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carboxylate.
| Compound Name | methyl 3-[(2E)-2-cyclopentyloxyiminoethyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 129011847 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | methyl 3-[(2E)-2-cyclopentyloxyiminoethyl]-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N=C(C)C(C/C=N/OC2CCCC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H27N3O5/c1-14-19(11-12-23-30-18-9-4-5-10-18)21(20(15(2)24-14)22(26)29-3)16-7-6-8-17(13-16)25(27)28/h6-8,12-13,18-19,21H,4-5,9-11H2,1-3H3/b23-12+ |
| InChIKey | PBVMWZUKHYROHF-FSJBWODESA-N |
| XLogP | 4.55 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|