C23H30N3O6+ — CID 7072746
3-O-ethyl 5-O-[(3R)-1-methylpiperidin-1-ium-3-yl] (4R)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 7072746) has the molecular formula C23H30N3O6+ and a molecular weight of 444.51 g/mol. Its IUPAC name is 3-O-ethyl 5-O-[(3R)-1-methylpiperidin-1-ium-3-yl] (4R)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-[(3R)-1-methylpiperidin-1-ium-3-yl] (4R)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 7072746 |
| Molecular Formula | C23H30N3O6+ |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 3-O-ethyl 5-O-[(3R)-1-methylpiperidin-1-ium-3-yl] (4R)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1C(C)=NC(C)=C(C(=O)O[C@@H]2CCC[NH+](C)C2)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H29N3O6/c1-5-31-22(27)19-14(2)24-15(3)20(23(28)32-18-10-7-11-25(4)13-18)21(19)16-8-6-9-17(12-16)26(29)30/h6,8-9,12,18-19,21H,5,7,10-11,13H2,1-4H3/p+1/t18-,19?,21+/m1/s1 |
| InChIKey | SZPPQTRSEXPWNR-DRPMKMPGSA-O |
| XLogP | 1.83 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|