C24H31N3O7S — CID 54464863
cyclopentyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[2-(propan-2-ylsulfamoyl)acetyl]-3,4-dihydropyridine-3-carboxylate (PubChem CID 54464863) has the molecular formula C24H31N3O7S and a molecular weight of 505.59 g/mol. Its IUPAC name is cyclopentyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[2-(propan-2-ylsulfamoyl)acetyl]-3,4-dihydropyridine-3-carboxylate.
| Compound Name | cyclopentyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[2-(propan-2-ylsulfamoyl)acetyl]-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 54464863 |
| Molecular Formula | C24H31N3O7S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | cyclopentyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[2-(propan-2-ylsulfamoyl)acetyl]-3,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=NC(C)=C(C(=O)CS(=O)(=O)NC(C)C)C(c2cccc([N+](=O)[O-])c2)C1C(=O)OC1CCCC1 |
| InChI | InChI=1S/C24H31N3O7S/c1-14(2)26-35(32,33)13-20(28)21-15(3)25-16(4)22(24(29)34-19-10-5-6-11-19)23(21)17-8-7-9-18(12-17)27(30)31/h7-9,12,14,19,22-23,26H,5-6,10-11,13H2,1-4H3 |
| InChIKey | XECXENDSGLCVEQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|