C21H23FN2O7 — CID 54518497
3-O-methyl 5-O-(oxan-4-yl) 6-(fluoromethyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54518497) has the molecular formula C21H23FN2O7 and a molecular weight of 434.42 g/mol. Its IUPAC name is 3-O-methyl 5-O-(oxan-4-yl) 6-(fluoromethyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-(oxan-4-yl) 6-(fluoromethyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54518497 |
| Molecular Formula | C21H23FN2O7 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-O-methyl 5-O-(oxan-4-yl) 6-(fluoromethyl)-2-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(CF)=C(C(=O)OC2CCOCC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23FN2O7/c1-12-17(20(25)29-2)18(13-4-3-5-14(10-13)24(27)28)19(16(11-22)23-12)21(26)31-15-6-8-30-9-7-15/h3-5,10,15,17-18H,6-9,11H2,1-2H3 |
| InChIKey | YOBURKUCSPPHRU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|