C19H19NO2S — CID 129012306
2-(5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine (PubChem CID 129012306) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-(5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 129012306 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1=C2c3ccccc3S(=O)(=O)C2c2ccccc21 |
| InChI | InChI=1S/C19H19NO2S/c1-20(2)12-11-14-13-7-3-4-8-15(13)19-18(14)16-9-5-6-10-17(16)23(19,21)22/h3-10,19H,11-12H2,1-2H3 |
| InChIKey | KXDPCPVDXHAWQR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|