C25H23NO2S — CID 129012312
2-(5,5-dioxo-2-phenyl-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine (PubChem CID 129012312) has the molecular formula C25H23NO2S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-(5,5-dioxo-2-phenyl-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(5,5-dioxo-2-phenyl-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 129012312 |
| Molecular Formula | C25H23NO2S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-(5,5-dioxo-2-phenyl-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1=C2c3ccccc3S(=O)(=O)C2c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C25H23NO2S/c1-26(2)15-14-19-22-16-18(17-8-4-3-5-9-17)12-13-20(22)25-24(19)21-10-6-7-11-23(21)29(25,27)28/h3-13,16,25H,14-15H2,1-2H3 |
| InChIKey | NSZUSOVLZLDHRX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|