C23H26FNO2S — CID 147043157
(2R)-2-[[6-[2-(4-fluorophenyl)sulfonylethyl]-3H-inden-1-yl]methyl]-1-methylpyrrolidine (PubChem CID 147043157) has the molecular formula C23H26FNO2S and a molecular weight of 399.53 g/mol. Its IUPAC name is (2R)-2-[[6-[2-(4-fluorophenyl)sulfonylethyl]-3H-inden-1-yl]methyl]-1-methylpyrrolidine.
| Compound Name | (2R)-2-[[6-[2-(4-fluorophenyl)sulfonylethyl]-3H-inden-1-yl]methyl]-1-methylpyrrolidine |
|---|---|
| PubChem CID | 147043157 |
| Molecular Formula | C23H26FNO2S |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (2R)-2-[[6-[2-(4-fluorophenyl)sulfonylethyl]-3H-inden-1-yl]methyl]-1-methylpyrrolidine |
| SMILES | CN1CCC[C@@H]1CC1=CCc2ccc(CCS(=O)(=O)c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C23H26FNO2S/c1-25-13-2-3-21(25)16-19-7-6-18-5-4-17(15-23(18)19)12-14-28(26,27)22-10-8-20(24)9-11-22/h4-5,7-11,15,21H,2-3,6,12-14,16H2,1H3/t21-/m1/s1 |
| InChIKey | AZVPZNPZSFWRMW-OAQYLSRUSA-N |
| XLogP | 4.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |