C20H20FNO2S — CID 129012308
1-(2-fluoro-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine (PubChem CID 129012308) has the molecular formula C20H20FNO2S and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-(2-fluoro-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine.
| Compound Name | 1-(2-fluoro-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 129012308 |
| Molecular Formula | C20H20FNO2S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-(2-fluoro-5,5-dioxo-4bH-indeno[1,2-b][1]benzothiol-10-yl)-N,N-dimethylpropan-2-amine |
| SMILES | CC(CC1=C2c3ccccc3S(=O)(=O)C2c2ccc(F)cc21)N(C)C |
| InChI | InChI=1S/C20H20FNO2S/c1-12(22(2)3)10-17-16-11-13(21)8-9-14(16)20-19(17)15-6-4-5-7-18(15)25(20,23)24/h4-9,11-12,20H,10H2,1-3H3 |
| InChIKey | VUWIRSGXNHVLQE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|